C29H30N4O4 — CID 54532021
methyl 3-[[2-[2-(N'-acetyloxycarbamimidoyl)phenyl]phenyl]methyl]-2-butylbenzimidazole-4-carboxylate (PubChem CID 54532021) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is methyl 3-[[2-[2-(N'-acetyloxycarbamimidoyl)phenyl]phenyl]methyl]-2-butylbenzimidazole-4-carboxylate.
| Compound Name | methyl 3-[[2-[2-(N'-acetyloxycarbamimidoyl)phenyl]phenyl]methyl]-2-butylbenzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 54532021 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | methyl 3-[[2-[2-(N'-acetyloxycarbamimidoyl)phenyl]phenyl]methyl]-2-butylbenzimidazole-4-carboxylate |
| SMILES | CCCCc1nc2cccc(C(=O)OC)c2n1Cc1ccccc1-c1ccccc1C(N)=NOC(C)=O |
| InChI | InChI=1S/C29H30N4O4/c1-4-5-17-26-31-25-16-10-15-24(29(35)36-3)27(25)33(26)18-20-11-6-7-12-21(20)22-13-8-9-14-23(22)28(30)32-37-19(2)34/h6-16H,4-5,17-18H2,1-3H3,(H2,30,32) |
| InChIKey | YXEZRZOVLZCEAD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|