C28H27N3O2 — CID 54257699
ethyl 2-butyl-3-[[2-(2-cyanophenyl)phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 54257699) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl 2-butyl-3-[[2-(2-cyanophenyl)phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | ethyl 2-butyl-3-[[2-(2-cyanophenyl)phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 54257699 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | ethyl 2-butyl-3-[[2-(2-cyanophenyl)phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCCCc1nc2cccc(C(=O)OCC)c2n1Cc1ccccc1-c1ccccc1C#N |
| InChI | InChI=1S/C28H27N3O2/c1-3-5-17-26-30-25-16-10-15-24(28(32)33-4-2)27(25)31(26)19-21-12-7-9-14-23(21)22-13-8-6-11-20(22)18-29/h6-16H,3-5,17,19H2,1-2H3 |
| InChIKey | RBGDZXHLUKCGCG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |