C25H21N3O2 — CID 19792126
ethyl 3-[(3-cyano-4-phenylphenyl)methyl]-2-methylbenzimidazole-4-carboxylate (PubChem CID 19792126) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 3-[(3-cyano-4-phenylphenyl)methyl]-2-methylbenzimidazole-4-carboxylate.
| Compound Name | ethyl 3-[(3-cyano-4-phenylphenyl)methyl]-2-methylbenzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 19792126 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | ethyl 3-[(3-cyano-4-phenylphenyl)methyl]-2-methylbenzimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cccc2nc(C)n(Cc3ccc(-c4ccccc4)c(C#N)c3)c12 |
| InChI | InChI=1S/C25H21N3O2/c1-3-30-25(29)22-10-7-11-23-24(22)28(17(2)27-23)16-18-12-13-21(20(14-18)15-26)19-8-5-4-6-9-19/h4-14H,3,16H2,1-2H3 |
| InChIKey | UMCHPDJIXVZVPH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |