C29H26N4O7 — CID 90027762
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-ethoxy-3-[[3-(N'-hydroxycarbamimidoyl)-4-phenylphenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 90027762) has the molecular formula C29H26N4O7 and a molecular weight of 542.55 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-ethoxy-3-[[3-(N'-hydroxycarbamimidoyl)-4-phenylphenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-ethoxy-3-[[3-(N'-hydroxycarbamimidoyl)-4-phenylphenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 90027762 |
| Molecular Formula | C29H26N4O7 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-ethoxy-3-[[3-(N'-hydroxycarbamimidoyl)-4-phenylphenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OCc3oc(=O)oc3C)c2n1Cc1ccc(-c2ccccc2)c(C(N)=NO)c1 |
| InChI | InChI=1S/C29H26N4O7/c1-3-37-28-31-23-11-7-10-21(27(34)38-16-24-17(2)39-29(35)40-24)25(23)33(28)15-18-12-13-20(19-8-5-4-6-9-19)22(14-18)26(30)32-36/h4-14,36H,3,15-16H2,1-2H3,(H2,30,32) |
| InChIKey | YMKCLKQCZSSANN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 155.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|