C29H28N4O7 — CID 172957931
2-[4-[[2-ethoxy-7-[hydroxy-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]methyl]benzimidazol-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 172957931) has the molecular formula C29H28N4O7 and a molecular weight of 544.56 g/mol. Its IUPAC name is 2-[4-[[2-ethoxy-7-[hydroxy-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]methyl]benzimidazol-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[4-[[2-ethoxy-7-[hydroxy-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]methyl]benzimidazol-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 172957931 |
| Molecular Formula | C29H28N4O7 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 2-[4-[[2-ethoxy-7-[hydroxy-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]methyl]benzimidazol-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCOc1nc2cccc(C(O)OCc3oc(=O)oc3C)c2n1Cc1ccc(-c2ccccc2/C(N)=N/O)cc1 |
| InChI | InChI=1S/C29H28N4O7/c1-3-37-28-31-23-10-6-9-22(27(34)38-16-24-17(2)39-29(35)40-24)25(23)33(28)15-18-11-13-19(14-12-18)20-7-4-5-8-21(20)26(30)32-36/h4-14,27,34,36H,3,15-16H2,1-2H3,(H2,30,32) |
| InChIKey | FLSJMEBDTIICNX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|