C30H26KN4O8- — CID 140732249
CID 140732249 (PubChem CID 140732249) has the molecular formula C30H26KN4O8- and a molecular weight of 609.66 g/mol.
| Compound Name | CID 140732249 |
|---|---|
| PubChem CID | 140732249 |
| Molecular Formula | C30H26KN4O8- |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | — |
| SMILES | CCOc1nc2cccc(C(=O)OCc3oc(=O)oc3C)c2n1Cc1ccc(-c2ccccc2C2=N[CH-]ON2)cc1.[K+].[OH-] |
| InChI | InChI=1S/C30H25N4O7.K.H2O/c1-3-37-29-32-24-10-6-9-23(28(35)38-16-25-18(2)40-30(36)41-25)26(24)34(29)15-19-11-13-20(14-12-19)21-7-4-5-8-22(21)27-31-17-39-33-27;;/h4-14,17H,3,15-16H2,1-2H3,(H,31,33);;1H2/q-1;+1;/p-1 |
| InChIKey | STXIEXUWZUSSRK-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|