C25H20ClN3O2 — CID 15654664
ethyl 2-(chloromethyl)-3-[[4-(2-cyanophenyl)phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 15654664) has the molecular formula C25H20ClN3O2 and a molecular weight of 429.91 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-3-[[4-(2-cyanophenyl)phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | ethyl 2-(chloromethyl)-3-[[4-(2-cyanophenyl)phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 15654664 |
| Molecular Formula | C25H20ClN3O2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | ethyl 2-(chloromethyl)-3-[[4-(2-cyanophenyl)phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cccc2nc(CCl)n(Cc3ccc(-c4ccccc4C#N)cc3)c12 |
| InChI | InChI=1S/C25H20ClN3O2/c1-2-31-25(30)21-8-5-9-22-24(21)29(23(14-26)28-22)16-17-10-12-18(13-11-17)20-7-4-3-6-19(20)15-27/h3-13H,2,14,16H2,1H3 |
| InChIKey | KETZMIYKSHFWQB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|