C27H24N2O2 — CID 146619235
1-[2-ethoxy-3-[[4-(2-prop-1-ynylphenyl)phenyl]methyl]benzimidazol-4-yl]ethanone (PubChem CID 146619235) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[2-ethoxy-3-[[4-(2-prop-1-ynylphenyl)phenyl]methyl]benzimidazol-4-yl]ethanone.
| Compound Name | 1-[2-ethoxy-3-[[4-(2-prop-1-ynylphenyl)phenyl]methyl]benzimidazol-4-yl]ethanone |
|---|---|
| PubChem CID | 146619235 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[2-ethoxy-3-[[4-(2-prop-1-ynylphenyl)phenyl]methyl]benzimidazol-4-yl]ethanone |
| SMILES | CC#Cc1ccccc1-c1ccc(Cn2c(OCC)nc3cccc(C(C)=O)c32)cc1 |
| InChI | InChI=1S/C27H24N2O2/c1-4-9-21-10-6-7-11-24(21)22-16-14-20(15-17-22)18-29-26-23(19(3)30)12-8-13-25(26)28-27(29)31-5-2/h6-8,10-17H,5,18H2,1-3H3 |
| InChIKey | KCZPGBOTQVFYGH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|