C24H25N3O2 — CID 19799548
ethyl 5-butyl-1-[(3-cyano-4-phenylphenyl)methyl]pyrazole-3-carboxylate (PubChem CID 19799548) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl 5-butyl-1-[(3-cyano-4-phenylphenyl)methyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-butyl-1-[(3-cyano-4-phenylphenyl)methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19799548 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | ethyl 5-butyl-1-[(3-cyano-4-phenylphenyl)methyl]pyrazole-3-carboxylate |
| SMILES | CCCCc1cc(C(=O)OCC)nn1Cc1ccc(-c2ccccc2)c(C#N)c1 |
| InChI | InChI=1S/C24H25N3O2/c1-3-5-11-21-15-23(24(28)29-4-2)26-27(21)17-18-12-13-22(20(14-18)16-25)19-9-7-6-8-10-19/h6-10,12-15H,3-5,11,17H2,1-2H3 |
| InChIKey | UJBCVLBSRYGMKX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |