ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate

C22H24N2O2 — CID 141430233

IUPACethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate
SMILESCCCCc1cc(C(=O)OCC)nn1-c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C22H24N2O2/c1-3-5-11-20-16-21(22(25)26-4-2)23-24(20)19-14-12-18(13-15-19)17-9-7-6-8-10-17/h6-10,12-16H,3-5,11H2,1-2H3
InChIKeyBVVVGRDOVQUPSQ-UHFFFAOYSA-N
MW348.45 g/mol
LogP5.06
Rot. Bonds7

About ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate

ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate (PubChem CID 141430233) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate.

Molecular Properties

Compound Nameethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate
PubChem CID141430233
Molecular FormulaC22H24N2O2
Molecular Weight348.45 g/mol
Exact Mass348.18
IUPAC Nameethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate
SMILESCCCCc1cc(C(=O)OCC)nn1-c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C22H24N2O2/c1-3-5-11-20-16-21(22(25)26-4-2)23-24(20)19-14-12-18(13-15-19)17-9-7-6-8-10-17/h6-10,12-16H,3-5,11H2,1-2H3
InChIKeyBVVVGRDOVQUPSQ-UHFFFAOYSA-N
XLogP5.06
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500348.45
LogP ≤ 55.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate?
The IUPAC name of ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate (CID 141430233) is ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate?
The canonical SMILES for ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate is CCCCc1cc(C(=O)OCC)nn1-c1ccc(-c2ccccc2)cc1.
What is the InChIKey of ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate?
The InChIKey is BVVVGRDOVQUPSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2/c1-3-5-11-20-16-21(22(25)26-4-2)23-24(20)19-14-12-18(13-15-19)17-9-7-6-8-10-17/h6-10,12-16H,3-5,11H2,1-2H3.
What are the key properties of ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate?
ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate has a molecular weight of 348.45 g/mol, XLogP of 5.06, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-butyl-1-(4-phenylphenyl)pyrazole-3-carboxylate is sourced from PubChem (CID 141430233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).