C27H24N4 — CID 19792198
5-[[2-butyl-7-(cyanomethyl)benzimidazol-1-yl]methyl]-2-phenylbenzonitrile (PubChem CID 19792198) has the molecular formula C27H24N4 and a molecular weight of 404.52 g/mol. Its IUPAC name is 5-[[2-butyl-7-(cyanomethyl)benzimidazol-1-yl]methyl]-2-phenylbenzonitrile.
| Compound Name | 5-[[2-butyl-7-(cyanomethyl)benzimidazol-1-yl]methyl]-2-phenylbenzonitrile |
|---|---|
| PubChem CID | 19792198 |
| Molecular Formula | C27H24N4 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 5-[[2-butyl-7-(cyanomethyl)benzimidazol-1-yl]methyl]-2-phenylbenzonitrile |
| SMILES | CCCCc1nc2cccc(CC#N)c2n1Cc1ccc(-c2ccccc2)c(C#N)c1 |
| InChI | InChI=1S/C27H24N4/c1-2-3-12-26-30-25-11-7-10-22(15-16-28)27(25)31(26)19-20-13-14-24(23(17-20)18-29)21-8-5-4-6-9-21/h4-11,13-14,17H,2-3,12,15,19H2,1H3 |
| InChIKey | NZXSUMPYXHPHCW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |