C26H25ClN2O2 — CID 142633081
2-[[2-butyl-7-(chloromethyl)benzimidazol-1-yl]methyl]-6-phenylbenzoic acid (PubChem CID 142633081) has the molecular formula C26H25ClN2O2 and a molecular weight of 432.95 g/mol. Its IUPAC name is 2-[[2-butyl-7-(chloromethyl)benzimidazol-1-yl]methyl]-6-phenylbenzoic acid.
| Compound Name | 2-[[2-butyl-7-(chloromethyl)benzimidazol-1-yl]methyl]-6-phenylbenzoic acid |
|---|---|
| PubChem CID | 142633081 |
| Molecular Formula | C26H25ClN2O2 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[[2-butyl-7-(chloromethyl)benzimidazol-1-yl]methyl]-6-phenylbenzoic acid |
| SMILES | CCCCc1nc2cccc(CCl)c2n1Cc1cccc(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C26H25ClN2O2/c1-2-3-15-23-28-22-14-8-11-19(16-27)25(22)29(23)17-20-12-7-13-21(24(20)26(30)31)18-9-5-4-6-10-18/h4-14H,2-3,15-17H2,1H3,(H,30,31) |
| InChIKey | QZRVPUJWIRXMMO-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|