C15H20N2O4 — CID 89077541
methyl 3-(2,2-dimethoxyethyl)-2-ethylbenzimidazole-4-carboxylate (PubChem CID 89077541) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 3-(2,2-dimethoxyethyl)-2-ethylbenzimidazole-4-carboxylate.
| Compound Name | methyl 3-(2,2-dimethoxyethyl)-2-ethylbenzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 89077541 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 3-(2,2-dimethoxyethyl)-2-ethylbenzimidazole-4-carboxylate |
| SMILES | CCc1nc2cccc(C(=O)OC)c2n1CC(OC)OC |
| InChI | InChI=1S/C15H20N2O4/c1-5-12-16-11-8-6-7-10(15(18)21-4)14(11)17(12)9-13(19-2)20-3/h6-8,13H,5,9H2,1-4H3 |
| InChIKey | DZINMBPIBBCRLO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|