C23H28ClN3O — CID 154357337
2-[4-[[2-butyl-4-chloro-5-(ethoxymethyl)imidazol-1-yl]methyl]phenyl]aniline (PubChem CID 154357337) has the molecular formula C23H28ClN3O and a molecular weight of 397.95 g/mol. Its IUPAC name is 2-[4-[[2-butyl-4-chloro-5-(ethoxymethyl)imidazol-1-yl]methyl]phenyl]aniline.
| Compound Name | 2-[4-[[2-butyl-4-chloro-5-(ethoxymethyl)imidazol-1-yl]methyl]phenyl]aniline |
|---|---|
| PubChem CID | 154357337 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-[4-[[2-butyl-4-chloro-5-(ethoxymethyl)imidazol-1-yl]methyl]phenyl]aniline |
| SMILES | CCCCc1nc(Cl)c(COCC)n1Cc1ccc(-c2ccccc2N)cc1 |
| InChI | InChI=1S/C23H28ClN3O/c1-3-5-10-22-26-23(24)21(16-28-4-2)27(22)15-17-11-13-18(14-12-17)19-8-6-7-9-20(19)25/h6-9,11-14H,3-5,10,15-16,25H2,1-2H3 |
| InChIKey | MNHVQFSGJPXAHO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|