C21H22ClIN2O — CID 19955610
[2-butyl-5-chloro-3-[[4-(2-iodophenyl)phenyl]methyl]imidazol-4-yl]methanol (PubChem CID 19955610) has the molecular formula C21H22ClIN2O and a molecular weight of 480.78 g/mol. Its IUPAC name is [2-butyl-5-chloro-3-[[4-(2-iodophenyl)phenyl]methyl]imidazol-4-yl]methanol.
| Compound Name | [2-butyl-5-chloro-3-[[4-(2-iodophenyl)phenyl]methyl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 19955610 |
| Molecular Formula | C21H22ClIN2O |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | [2-butyl-5-chloro-3-[[4-(2-iodophenyl)phenyl]methyl]imidazol-4-yl]methanol |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2I)cc1 |
| InChI | InChI=1S/C21H22ClIN2O/c1-2-3-8-20-24-21(22)19(14-26)25(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)23/h4-7,9-12,26H,2-3,8,13-14H2,1H3 |
| InChIKey | XXYATGYHLNPUOL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|