C30H30ClF3N4O — CID 145473572
2-[4-[[2-butyl-4-chloro-5-[[3-(trifluoromethyl)phenyl]methoxymethyl]imidazol-1-yl]methyl]phenyl]benzenecarboximidamide (PubChem CID 145473572) has the molecular formula C30H30ClF3N4O and a molecular weight of 555.04 g/mol. Its IUPAC name is 2-[4-[[2-butyl-4-chloro-5-[[3-(trifluoromethyl)phenyl]methoxymethyl]imidazol-1-yl]methyl]phenyl]benzenecarboximidamide.
| Compound Name | 2-[4-[[2-butyl-4-chloro-5-[[3-(trifluoromethyl)phenyl]methoxymethyl]imidazol-1-yl]methyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145473572 |
| Molecular Formula | C30H30ClF3N4O |
| Molecular Weight | 555.04 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 2-[4-[[2-butyl-4-chloro-5-[[3-(trifluoromethyl)phenyl]methoxymethyl]imidazol-1-yl]methyl]phenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1-c1ccc(Cn2c(CCCC)nc(Cl)c2COCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C30H30ClF3N4O/c1-2-3-11-27-37-28(31)26(19-39-18-21-7-6-8-23(16-21)30(32,33)34)38(27)17-20-12-14-22(15-13-20)24-9-4-5-10-25(24)29(35)36/h4-10,12-16H,2-3,11,17-19H2,1H3,(H3,35,36) |
| InChIKey | PDCQYTNTODWEJN-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.04 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|