C30H31ClF3N5O — CID 145473575
N'-amino-2-[4-[[2-butyl-4-chloro-5-[[4-(trifluoromethyl)phenyl]methoxymethyl]imidazol-1-yl]methyl]phenyl]benzenecarboximidamide (PubChem CID 145473575) has the molecular formula C30H31ClF3N5O and a molecular weight of 570.06 g/mol. Its IUPAC name is N'-amino-2-[4-[[2-butyl-4-chloro-5-[[4-(trifluoromethyl)phenyl]methoxymethyl]imidazol-1-yl]methyl]phenyl]benzenecarboximidamide.
| Compound Name | N'-amino-2-[4-[[2-butyl-4-chloro-5-[[4-(trifluoromethyl)phenyl]methoxymethyl]imidazol-1-yl]methyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145473575 |
| Molecular Formula | C30H31ClF3N5O |
| Molecular Weight | 570.06 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | N'-amino-2-[4-[[2-butyl-4-chloro-5-[[4-(trifluoromethyl)phenyl]methoxymethyl]imidazol-1-yl]methyl]phenyl]benzenecarboximidamide |
| SMILES | CCCCc1nc(Cl)c(COCc2ccc(C(F)(F)F)cc2)n1Cc1ccc(-c2ccccc2/C(N)=N/N)cc1 |
| InChI | InChI=1S/C30H31ClF3N5O/c1-2-3-8-27-37-28(31)26(19-40-18-21-11-15-23(16-12-21)30(32,33)34)39(27)17-20-9-13-22(14-10-20)24-6-4-5-7-25(24)29(35)38-36/h4-7,9-16H,2-3,8,17-19,36H2,1H3,(H2,35,38) |
| InChIKey | HITRAXFDGLWSCX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.06 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|