C28H29FN4O2 — CID 86672448
2-[4-[[2-butyl-4-(4-fluorophenyl)-5-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 86672448) has the molecular formula C28H29FN4O2 and a molecular weight of 472.56 g/mol. Its IUPAC name is 2-[4-[[2-butyl-4-(4-fluorophenyl)-5-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[4-[[2-butyl-4-(4-fluorophenyl)-5-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 86672448 |
| Molecular Formula | C28H29FN4O2 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2-[4-[[2-butyl-4-(4-fluorophenyl)-5-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCCCc1nc(-c2ccc(F)cc2)c(CO)n1Cc1ccc(-c2ccccc2C(N)=NO)cc1 |
| InChI | InChI=1S/C28H29FN4O2/c1-2-3-8-26-31-27(21-13-15-22(29)16-14-21)25(18-34)33(26)17-19-9-11-20(12-10-19)23-6-4-5-7-24(23)28(30)32-35/h4-7,9-16,34-35H,2-3,8,17-18H2,1H3,(H2,30,32) |
| InChIKey | RORJRIGMEWZKLR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|