C29H32N6O4 — CID 148550129
methyl 2-butyl-5-(5-ethoxypyrimidin-2-yl)-3-[[4-[2-(N'-hydroxycarbamimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 148550129) has the molecular formula C29H32N6O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is methyl 2-butyl-5-(5-ethoxypyrimidin-2-yl)-3-[[4-[2-(N'-hydroxycarbamimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | methyl 2-butyl-5-(5-ethoxypyrimidin-2-yl)-3-[[4-[2-(N'-hydroxycarbamimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 148550129 |
| Molecular Formula | C29H32N6O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | methyl 2-butyl-5-(5-ethoxypyrimidin-2-yl)-3-[[4-[2-(N'-hydroxycarbamimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(-c2ncc(OCC)cn2)c(C(=O)OC)n1Cc1ccc(-c2ccccc2C(N)=NO)cc1 |
| InChI | InChI=1S/C29H32N6O4/c1-4-6-11-24-33-25(28-31-16-21(17-32-28)39-5-2)26(29(36)38-3)35(24)18-19-12-14-20(15-13-19)22-9-7-8-10-23(22)27(30)34-37/h7-10,12-17,37H,4-6,11,18H2,1-3H3,(H2,30,34) |
| InChIKey | RRGHNOBEPZQLFR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|