C24H24ClI2N3O2 — CID 173484752
iodomethyl 2-butyl-5-chloro-3-[[4-[2-(N-iodo-C-methylcarbonimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 173484752) has the molecular formula C24H24ClI2N3O2 and a molecular weight of 675.74 g/mol. Its IUPAC name is iodomethyl 2-butyl-5-chloro-3-[[4-[2-(N-iodo-C-methylcarbonimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | iodomethyl 2-butyl-5-chloro-3-[[4-[2-(N-iodo-C-methylcarbonimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 173484752 |
| Molecular Formula | C24H24ClI2N3O2 |
| Molecular Weight | 675.74 g/mol |
| Exact Mass | 674.96 |
| IUPAC Name | iodomethyl 2-butyl-5-chloro-3-[[4-[2-(N-iodo-C-methylcarbonimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OCI)n1Cc1ccc(-c2ccccc2C(C)=NI)cc1 |
| InChI | InChI=1S/C24H24ClI2N3O2/c1-3-4-9-21-28-23(25)22(24(31)32-15-26)30(21)14-17-10-12-18(13-11-17)20-8-6-5-7-19(20)16(2)29-27/h5-8,10-13H,3-4,9,14-15H2,1-2H3 |
| InChIKey | YYOORDCYINKHLS-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.74 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|