C32H34ClN6O4+ — CID 143528067
amino-[(Z)-[amino-[2-[4-[[2-butyl-4-chloro-5-[2-(3-oxo-1H-2-benzofuran-1-yl)ethoxycarbonyl]imidazol-1-yl]methyl]phenyl]phenyl]methylidene]amino]azanium (PubChem CID 143528067) has the molecular formula C32H34ClN6O4+ and a molecular weight of 602.12 g/mol. Its IUPAC name is amino-[(Z)-[amino-[2-[4-[[2-butyl-4-chloro-5-[2-(3-oxo-1H-2-benzofuran-1-yl)ethoxycarbonyl]imidazol-1-yl]methyl]phenyl]phenyl]methylidene]amino]azanium.
| Compound Name | amino-[(Z)-[amino-[2-[4-[[2-butyl-4-chloro-5-[2-(3-oxo-1H-2-benzofuran-1-yl)ethoxycarbonyl]imidazol-1-yl]methyl]phenyl]phenyl]methylidene]amino]azanium |
|---|---|
| PubChem CID | 143528067 |
| Molecular Formula | C32H34ClN6O4+ |
| Molecular Weight | 602.12 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | amino-[(Z)-[amino-[2-[4-[[2-butyl-4-chloro-5-[2-(3-oxo-1H-2-benzofuran-1-yl)ethoxycarbonyl]imidazol-1-yl]methyl]phenyl]phenyl]methylidene]amino]azanium |
| SMILES | CCCCc1nc(Cl)c(C(=O)OCCC2OC(=O)c3ccccc32)n1Cc1ccc(-c2ccccc2/C(N)=N/[NH2+]N)cc1 |
| InChI | InChI=1S/C32H33ClN6O4/c1-2-3-12-27-36-29(33)28(32(41)42-18-17-26-23-9-5-7-11-25(23)31(40)43-26)39(27)19-20-13-15-21(16-14-20)22-8-4-6-10-24(22)30(34)37-38-35/h4-11,13-16,26,38H,2-3,12,17-19,35H2,1H3,(H2,34,37)/p+1 |
| InChIKey | OBGNSJJSPXZZSC-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 151.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.12 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|