C30H40N4O4 — CID 163884610
2-[4-[[2-butyl-5-(2-ethoxy-2-hydroxypropyl)-6-oxo-4-propan-2-ylpyrimidin-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 163884610) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is 2-[4-[[2-butyl-5-(2-ethoxy-2-hydroxypropyl)-6-oxo-4-propan-2-ylpyrimidin-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[4-[[2-butyl-5-(2-ethoxy-2-hydroxypropyl)-6-oxo-4-propan-2-ylpyrimidin-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 163884610 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 2-[4-[[2-butyl-5-(2-ethoxy-2-hydroxypropyl)-6-oxo-4-propan-2-ylpyrimidin-1-yl]methyl]phenyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCCCc1nc(C(C)C)c(CC(C)(O)OCC)c(=O)n1Cc1ccc(-c2ccccc2C(N)=NO)cc1 |
| InChI | InChI=1S/C30H40N4O4/c1-6-8-13-26-32-27(20(3)4)25(18-30(5,36)38-7-2)29(35)34(26)19-21-14-16-22(17-15-21)23-11-9-10-12-24(23)28(31)33-37/h9-12,14-17,20,36-37H,6-8,13,18-19H2,1-5H3,(H2,31,33) |
| InChIKey | PWGSTEBVEWXVOW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|