C24H29N6O+ — CID 167471716
[(Z)-C-[2-[4-[[2-butyl-5-(hydroxymethyl)-4-methylimidazol-1-yl]methyl]phenyl]phenyl]-N-hydrazinylcarbonimidoyl]-methylidyneazanium (PubChem CID 167471716) has the molecular formula C24H29N6O+ and a molecular weight of 417.54 g/mol. Its IUPAC name is [(Z)-C-[2-[4-[[2-butyl-5-(hydroxymethyl)-4-methylimidazol-1-yl]methyl]phenyl]phenyl]-N-hydrazinylcarbonimidoyl]-methylidyneazanium.
| Compound Name | [(Z)-C-[2-[4-[[2-butyl-5-(hydroxymethyl)-4-methylimidazol-1-yl]methyl]phenyl]phenyl]-N-hydrazinylcarbonimidoyl]-methylidyneazanium |
|---|---|
| PubChem CID | 167471716 |
| Molecular Formula | C24H29N6O+ |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | [(Z)-C-[2-[4-[[2-butyl-5-(hydroxymethyl)-4-methylimidazol-1-yl]methyl]phenyl]phenyl]-N-hydrazinylcarbonimidoyl]-methylidyneazanium |
| SMILES | C#[N+]/C(=N\NN)c1ccccc1-c1ccc(Cn2c(CCCC)nc(C)c2CO)cc1 |
| InChI | InChI=1S/C24H29N6O/c1-4-5-10-23-27-17(2)22(16-31)30(23)15-18-11-13-19(14-12-18)20-8-6-7-9-21(20)24(26-3)28-29-25/h3,6-9,11-14,29,31H,4-5,10,15-16,25H2,1-2H3/q+1/b28-24- |
| InChIKey | XQTKULXDMCTJET-COOPMVRXSA-N |
| XLogP | 3.83 |
| TPSA | 92.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|