C36H35N5O — CID 19349858
3,5-bis[[4-(2-aminophenyl)phenyl]methyl]-2-butylimidazo[4,5-c]pyridin-4-one (PubChem CID 19349858) has the molecular formula C36H35N5O and a molecular weight of 553.71 g/mol. Its IUPAC name is 3,5-bis[[4-(2-aminophenyl)phenyl]methyl]-2-butylimidazo[4,5-c]pyridin-4-one.
| Compound Name | 3,5-bis[[4-(2-aminophenyl)phenyl]methyl]-2-butylimidazo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 19349858 |
| Molecular Formula | C36H35N5O |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 3,5-bis[[4-(2-aminophenyl)phenyl]methyl]-2-butylimidazo[4,5-c]pyridin-4-one |
| SMILES | CCCCc1nc2ccn(Cc3ccc(-c4ccccc4N)cc3)c(=O)c2n1Cc1ccc(-c2ccccc2N)cc1 |
| InChI | InChI=1S/C36H35N5O/c1-2-3-12-34-39-33-21-22-40(23-25-13-17-27(18-14-25)29-8-4-6-10-31(29)37)36(42)35(33)41(34)24-26-15-19-28(20-16-26)30-9-5-7-11-32(30)38/h4-11,13-22H,2-3,12,23-24,37-38H2,1H3 |
| InChIKey | HPULYAOYLORZCM-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|