C33H47N7O11 — CID 143266698
4-nitrooxybutyl 2-[[4-[2-[(Z)-N'-[amino(4-nitrooxybutoxycarbonyl)amino]carbamimidoyl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoate (PubChem CID 143266698) has the molecular formula C33H47N7O11 and a molecular weight of 717.78 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-[[4-[2-[(Z)-N'-[amino(4-nitrooxybutoxycarbonyl)amino]carbamimidoyl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoate.
| Compound Name | 4-nitrooxybutyl 2-[[4-[2-[(Z)-N'-[amino(4-nitrooxybutoxycarbonyl)amino]carbamimidoyl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 143266698 |
| Molecular Formula | C33H47N7O11 |
| Molecular Weight | 717.78 g/mol |
| Exact Mass | 717.33 |
| IUPAC Name | 4-nitrooxybutyl 2-[[4-[2-[(Z)-N'-[amino(4-nitrooxybutoxycarbonyl)amino]carbamimidoyl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoate |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2/C(N)=N/N(N)C(=O)OCCCCO[N+](=O)[O-])cc1)C(C(=O)OCCCCO[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C33H47N7O11/c1-4-5-14-29(41)37(30(24(2)3)32(42)48-19-8-10-21-50-39(44)45)23-25-15-17-26(18-16-25)27-12-6-7-13-28(27)31(34)36-38(35)33(43)49-20-9-11-22-51-40(46)47/h6-7,12-13,15-18,24,30H,4-5,8-11,14,19-23,35H2,1-3H3,(H2,34,36) |
| InChIKey | BUBHOIZPLKMACE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 245.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|