C30H38N6O9 — CID 73066302
3-methyl-2-[[4-[2-[2-[1-(3-nitrooxypropoxycarbonyloxy)ethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]butanoic acid (PubChem CID 73066302) has the molecular formula C30H38N6O9 and a molecular weight of 626.67 g/mol. Its IUPAC name is 3-methyl-2-[[4-[2-[2-[1-(3-nitrooxypropoxycarbonyloxy)ethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]butanoic acid.
| Compound Name | 3-methyl-2-[[4-[2-[2-[1-(3-nitrooxypropoxycarbonyloxy)ethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 73066302 |
| Molecular Formula | C30H38N6O9 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | 3-methyl-2-[[4-[2-[2-[1-(3-nitrooxypropoxycarbonyloxy)ethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]butanoic acid |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2-c2nnn(C(C)OC(=O)OCCCO[N+](=O)[O-])n2)cc1)C(C(=O)O)C(C)C |
| InChI | InChI=1S/C30H38N6O9/c1-5-6-12-26(37)34(27(20(2)3)29(38)39)19-22-13-15-23(16-14-22)24-10-7-8-11-25(24)28-31-33-35(32-28)21(4)45-30(40)43-17-9-18-44-36(41)42/h7-8,10-11,13-16,20-21,27H,5-6,9,12,17-19H2,1-4H3,(H,38,39) |
| InChIKey | KWOYUYYZUVHWCY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 189.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|