C24H28N6O4 — CID 169444524
(2S)-3-methyl-2-[[4-[2-(2-nitrosotetrazol-5-yl)phenyl]phenyl]methyl-pentanoylamino]butanoic acid (PubChem CID 169444524) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[4-[2-(2-nitrosotetrazol-5-yl)phenyl]phenyl]methyl-pentanoylamino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[4-[2-(2-nitrosotetrazol-5-yl)phenyl]phenyl]methyl-pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 169444524 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (2S)-3-methyl-2-[[4-[2-(2-nitrosotetrazol-5-yl)phenyl]phenyl]methyl-pentanoylamino]butanoic acid |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2-c2nnn(N=O)n2)cc1)[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C24H28N6O4/c1-4-5-10-21(31)29(22(16(2)3)24(32)33)15-17-11-13-18(14-12-17)19-8-6-7-9-20(19)23-25-27-30(26-23)28-34/h6-9,11-14,16,22H,4-5,10,15H2,1-3H3,(H,32,33)/t22-/m0/s1 |
| InChIKey | DRIWXJGPMLVZSF-QFIPXVFZSA-N |
| XLogP | 4.16 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|