C32H36N6O7 — CID 70324665
(2S)-2-[[4-[2-[2-[3-[(dihydroxyamino)oxymethyl]benzoyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid (PubChem CID 70324665) has the molecular formula C32H36N6O7 and a molecular weight of 616.68 g/mol. Its IUPAC name is (2S)-2-[[4-[2-[2-[3-[(dihydroxyamino)oxymethyl]benzoyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[4-[2-[2-[3-[(dihydroxyamino)oxymethyl]benzoyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 70324665 |
| Molecular Formula | C32H36N6O7 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | (2S)-2-[[4-[2-[2-[3-[(dihydroxyamino)oxymethyl]benzoyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2-c2nnn(C(=O)c3cccc(CON(O)O)c3)n2)cc1)[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C32H36N6O7/c1-4-5-13-28(39)36(29(21(2)3)32(41)42)19-22-14-16-24(17-15-22)26-11-6-7-12-27(26)30-33-35-37(34-30)31(40)25-10-8-9-23(18-25)20-45-38(43)44/h6-12,14-18,21,29,43-44H,4-5,13,19-20H2,1-3H3,(H,41,42)/t29-/m0/s1 |
| InChIKey | FCQDOPSVXLMRBM-LJAQVGFWSA-N |
| XLogP | 4.84 |
| TPSA | 171.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|