C30H40N6O9S — CID 70324842
(2S)-2-[[4-[2-[2-[2-[2-(dihydroxyamino)oxyethylsulfanyl]ethoxycarbonyloxymethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid (PubChem CID 70324842) has the molecular formula C30H40N6O9S and a molecular weight of 660.75 g/mol. Its IUPAC name is (2S)-2-[[4-[2-[2-[2-[2-(dihydroxyamino)oxyethylsulfanyl]ethoxycarbonyloxymethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[4-[2-[2-[2-[2-(dihydroxyamino)oxyethylsulfanyl]ethoxycarbonyloxymethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 70324842 |
| Molecular Formula | C30H40N6O9S |
| Molecular Weight | 660.75 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | (2S)-2-[[4-[2-[2-[2-[2-(dihydroxyamino)oxyethylsulfanyl]ethoxycarbonyloxymethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2-c2nnn(COC(=O)OCCSCCON(O)O)n2)cc1)[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C30H40N6O9S/c1-4-5-10-26(37)34(27(21(2)3)29(38)39)19-22-11-13-23(14-12-22)24-8-6-7-9-25(24)28-31-33-35(32-28)20-44-30(40)43-15-17-46-18-16-45-36(41)42/h6-9,11-14,21,27,41-42H,4-5,10,15-20H2,1-3H3,(H,38,39)/t27-/m0/s1 |
| InChIKey | DYSNWGPGNDWGDE-MHZLTWQESA-N |
| XLogP | 4.49 |
| TPSA | 189.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.75 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|