C31H42N6O9 — CID 70324417
(2S)-2-[[4-[2-[2-[5-(dihydroxyamino)oxypentoxycarbonyloxymethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid (PubChem CID 70324417) has the molecular formula C31H42N6O9 and a molecular weight of 642.71 g/mol. Its IUPAC name is (2S)-2-[[4-[2-[2-[5-(dihydroxyamino)oxypentoxycarbonyloxymethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[4-[2-[2-[5-(dihydroxyamino)oxypentoxycarbonyloxymethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 70324417 |
| Molecular Formula | C31H42N6O9 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | (2S)-2-[[4-[2-[2-[5-(dihydroxyamino)oxypentoxycarbonyloxymethyl]tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]-3-methylbutanoic acid |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2-c2nnn(COC(=O)OCCCCCON(O)O)n2)cc1)[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C31H42N6O9/c1-4-5-13-27(38)35(28(22(2)3)30(39)40)20-23-14-16-24(17-15-23)25-11-7-8-12-26(25)29-32-34-36(33-29)21-45-31(41)44-18-9-6-10-19-46-37(42)43/h7-8,11-12,14-17,22,28,42-43H,4-6,9-10,13,18-21H2,1-3H3,(H,39,40)/t28-/m0/s1 |
| InChIKey | FXGOSMRIHJRPEU-NDEPHWFRSA-N |
| XLogP | 4.93 |
| TPSA | 189.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|