C29H36ClN7O7 — CID 70324653
[5-[2-[4-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]phenyl]tetrazol-2-yl]methyl 5-(dihydroxyamino)oxypentyl carbonate (PubChem CID 70324653) has the molecular formula C29H36ClN7O7 and a molecular weight of 630.10 g/mol. Its IUPAC name is [5-[2-[4-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]phenyl]tetrazol-2-yl]methyl 5-(dihydroxyamino)oxypentyl carbonate.
| Compound Name | [5-[2-[4-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]phenyl]tetrazol-2-yl]methyl 5-(dihydroxyamino)oxypentyl carbonate |
|---|---|
| PubChem CID | 70324653 |
| Molecular Formula | C29H36ClN7O7 |
| Molecular Weight | 630.10 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | [5-[2-[4-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]phenyl]tetrazol-2-yl]methyl 5-(dihydroxyamino)oxypentyl carbonate |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nnn(COC(=O)OCCCCCON(O)O)n2)cc1 |
| InChI | InChI=1S/C29H36ClN7O7/c1-2-3-11-26-31-27(30)25(19-38)35(26)18-21-12-14-22(15-13-21)23-9-5-6-10-24(23)28-32-34-36(33-28)20-43-29(39)42-16-7-4-8-17-44-37(40)41/h5-6,9-10,12-15,38,40-41H,2-4,7-8,11,16-20H2,1H3 |
| InChIKey | ZOTSJFLUOYHJRK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 170.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.10 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|