C39H49N7O12 — CID 143266838
[5-[2-[4-[[3-methylbutan-2-yl(pentanoyl)amino]methyl]phenyl]phenyl]tetrazol-2-yl]methyl [4-(nitrooxymethyl)phenyl]methyl carbonate;4-nitrooxybutyl formate (PubChem CID 143266838) has the molecular formula C39H49N7O12 and a molecular weight of 807.86 g/mol. Its IUPAC name is [5-[2-[4-[[3-methylbutan-2-yl(pentanoyl)amino]methyl]phenyl]phenyl]tetrazol-2-yl]methyl [4-(nitrooxymethyl)phenyl]methyl carbonate;4-nitrooxybutyl formate.
| Compound Name | [5-[2-[4-[[3-methylbutan-2-yl(pentanoyl)amino]methyl]phenyl]phenyl]tetrazol-2-yl]methyl [4-(nitrooxymethyl)phenyl]methyl carbonate;4-nitrooxybutyl formate |
|---|---|
| PubChem CID | 143266838 |
| Molecular Formula | C39H49N7O12 |
| Molecular Weight | 807.86 g/mol |
| Exact Mass | 807.34 |
| IUPAC Name | [5-[2-[4-[[3-methylbutan-2-yl(pentanoyl)amino]methyl]phenyl]phenyl]tetrazol-2-yl]methyl [4-(nitrooxymethyl)phenyl]methyl carbonate;4-nitrooxybutyl formate |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2-c2nnn(COC(=O)OCc3ccc(CO[N+](=O)[O-])cc3)n2)cc1)C(C)C(C)C.O=COCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C34H40N6O7.C5H9NO5/c1-5-6-11-32(41)38(25(4)24(2)3)20-26-16-18-29(19-17-26)30-9-7-8-10-31(30)33-35-37-39(36-33)23-46-34(42)45-21-27-12-14-28(15-13-27)22-47-40(43)44;7-5-10-3-1-2-4-11-6(8)9/h7-10,12-19,24-25H,5-6,11,20-23H2,1-4H3;5H,1-4H2 |
| InChIKey | SSRNDAQXQFTVBG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 230.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.86 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|