C29H36N6O9 — CID 11606908
(2R)-3-methyl-2-[[4-[2-[2-(3-nitrooxypropoxycarbonyloxymethyl)tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]butanoic acid (PubChem CID 11606908) has the molecular formula C29H36N6O9 and a molecular weight of 612.64 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[4-[2-[2-(3-nitrooxypropoxycarbonyloxymethyl)tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[4-[2-[2-(3-nitrooxypropoxycarbonyloxymethyl)tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 11606908 |
| Molecular Formula | C29H36N6O9 |
| Molecular Weight | 612.64 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | (2R)-3-methyl-2-[[4-[2-[2-(3-nitrooxypropoxycarbonyloxymethyl)tetrazol-5-yl]phenyl]phenyl]methyl-pentanoylamino]butanoic acid |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2-c2nnn(COC(=O)OCCCO[N+](=O)[O-])n2)cc1)[C@@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C29H36N6O9/c1-4-5-11-25(36)33(26(20(2)3)28(37)38)18-21-12-14-22(15-13-21)23-9-6-7-10-24(23)27-30-32-34(31-27)19-43-29(39)42-16-8-17-44-35(40)41/h6-7,9-10,12-15,20,26H,4-5,8,11,16-19H2,1-3H3,(H,37,38)/t26-/m1/s1 |
| InChIKey | JAALSBMVZCSEBV-AREMUKBSSA-N |
| XLogP | 4.34 |
| TPSA | 189.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|