C31H46N6O7 — CID 143266817
1-[amino-[(Z)-[amino-[2-[4-[[3-methylbutan-2-yl(pentanoyl)amino]methyl]phenyl]phenyl]methylidene]amino]amino]ethyl 4-nitrooxybutyl carbonate (PubChem CID 143266817) has the molecular formula C31H46N6O7 and a molecular weight of 614.74 g/mol. Its IUPAC name is 1-[amino-[(Z)-[amino-[2-[4-[[3-methylbutan-2-yl(pentanoyl)amino]methyl]phenyl]phenyl]methylidene]amino]amino]ethyl 4-nitrooxybutyl carbonate.
| Compound Name | 1-[amino-[(Z)-[amino-[2-[4-[[3-methylbutan-2-yl(pentanoyl)amino]methyl]phenyl]phenyl]methylidene]amino]amino]ethyl 4-nitrooxybutyl carbonate |
|---|---|
| PubChem CID | 143266817 |
| Molecular Formula | C31H46N6O7 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | 1-[amino-[(Z)-[amino-[2-[4-[[3-methylbutan-2-yl(pentanoyl)amino]methyl]phenyl]phenyl]methylidene]amino]amino]ethyl 4-nitrooxybutyl carbonate |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2/C(N)=N/N(N)C(C)OC(=O)OCCCCO[N+](=O)[O-])cc1)C(C)C(C)C |
| InChI | InChI=1S/C31H46N6O7/c1-6-7-14-29(38)35(23(4)22(2)3)21-25-15-17-26(18-16-25)27-12-8-9-13-28(27)30(32)34-36(33)24(5)44-31(39)42-19-10-11-20-43-37(40)41/h8-9,12-13,15-18,22-24H,6-7,10-11,14,19-21,33H2,1-5H3,(H2,32,34) |
| InChIKey | YMODRBFOPUZJEW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 175.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|