C24H33N5O — CID 169122311
N-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]-N-(3-methylbutan-2-yl)pentanamide (PubChem CID 169122311) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]-N-(3-methylbutan-2-yl)pentanamide.
| Compound Name | N-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]-N-(3-methylbutan-2-yl)pentanamide |
|---|---|
| PubChem CID | 169122311 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | N-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]-N-(3-methylbutan-2-yl)pentanamide |
| SMILES | [H]/N=C(\N=N\N)c1ccccc1-c1ccc(CN(C(=O)CCCC)C(C)C(C)C)cc1 |
| InChI | InChI=1S/C24H33N5O/c1-5-6-11-23(30)29(18(4)17(2)3)16-19-12-14-20(15-13-19)21-9-7-8-10-22(21)24(25)27-28-26/h7-10,12-15,17-18H,5-6,11,16H2,1-4H3,(H3,25,26,27) |
| InChIKey | IOSVHBCNYFSBQN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|