C26H32N4O2 — CID 149236617
N-(2-methyl-4-oxopentan-3-yl)-N-[[4-[2-(4H-triazol-5-yl)phenyl]phenyl]methyl]pentanamide (PubChem CID 149236617) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N-(2-methyl-4-oxopentan-3-yl)-N-[[4-[2-(4H-triazol-5-yl)phenyl]phenyl]methyl]pentanamide.
| Compound Name | N-(2-methyl-4-oxopentan-3-yl)-N-[[4-[2-(4H-triazol-5-yl)phenyl]phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 149236617 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | N-(2-methyl-4-oxopentan-3-yl)-N-[[4-[2-(4H-triazol-5-yl)phenyl]phenyl]methyl]pentanamide |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2C2=NN=NC2)cc1)C(C(C)=O)C(C)C |
| InChI | InChI=1S/C26H32N4O2/c1-5-6-11-25(32)30(26(18(2)3)19(4)31)17-20-12-14-21(15-13-20)22-9-7-8-10-23(22)24-16-27-29-28-24/h7-10,12-15,18,26H,5-6,11,16-17H2,1-4H3 |
| InChIKey | XLIUNKRXQYGNSJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 74.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |