C23H26N5O3 — CID 145030191
CID 145030191 (PubChem CID 145030191) has the molecular formula C23H26N5O3 and a molecular weight of 420.49 g/mol.
| Compound Name | CID 145030191 |
|---|---|
| PubChem CID | 145030191 |
| Molecular Formula | C23H26N5O3 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | — |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2[C]2N=NN=N2)cc1)C(CC)C(=O)O |
| InChI | InChI=1S/C23H26N5O3/c1-3-5-10-21(29)28(20(4-2)23(30)31)15-16-11-13-17(14-12-16)18-8-6-7-9-19(18)22-24-26-27-25-22/h6-9,11-14,20H,3-5,10,15H2,1-2H3,(H,30,31) |
| InChIKey | OCOPBYKIMTWDFM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |