C25H34IN3O2 — CID 142618890
N-[[4-[2-[(hydrazinyl-λ3-iodanylidene)methyl]phenyl]phenyl]methyl]-N-[(3S)-2-methyl-4-oxopentan-3-yl]pentanamide (PubChem CID 142618890) has the molecular formula C25H34IN3O2 and a molecular weight of 535.47 g/mol. Its IUPAC name is N-[[4-[2-[(hydrazinyl-λ3-iodanylidene)methyl]phenyl]phenyl]methyl]-N-[(3S)-2-methyl-4-oxopentan-3-yl]pentanamide.
| Compound Name | N-[[4-[2-[(hydrazinyl-λ3-iodanylidene)methyl]phenyl]phenyl]methyl]-N-[(3S)-2-methyl-4-oxopentan-3-yl]pentanamide |
|---|---|
| PubChem CID | 142618890 |
| Molecular Formula | C25H34IN3O2 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | N-[[4-[2-[(hydrazinyl-λ3-iodanylidene)methyl]phenyl]phenyl]methyl]-N-[(3S)-2-methyl-4-oxopentan-3-yl]pentanamide |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2/C=I/NN)cc1)[C@H](C(C)=O)C(C)C |
| InChI | InChI=1S/C25H34IN3O2/c1-5-6-11-24(31)29(25(18(2)3)19(4)30)17-20-12-14-21(15-13-20)23-10-8-7-9-22(23)16-26-28-27/h7-10,12-16,18,25,28H,5-6,11,17,27H2,1-4H3/t25-/m0/s1 |
| InChIKey | HAWXVJKHEYTWMO-VWLOTQADSA-N |
| XLogP | 4.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|