C32H39N5O2 — CID 67558522
benzyl (2S)-2-[hex-1-en-2-yl-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]amino]-3-methylbutanoate (PubChem CID 67558522) has the molecular formula C32H39N5O2 and a molecular weight of 525.70 g/mol. Its IUPAC name is benzyl (2S)-2-[hex-1-en-2-yl-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]amino]-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-[hex-1-en-2-yl-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 67558522 |
| Molecular Formula | C32H39N5O2 |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | benzyl (2S)-2-[hex-1-en-2-yl-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]amino]-3-methylbutanoate |
| SMILES | [H]/N=C(\N=N\N)c1ccccc1-c1ccc(CN(C(=C)CCCC)[C@H](C(=O)OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C32H39N5O2/c1-5-6-12-24(4)37(30(23(2)3)32(38)39-22-26-13-8-7-9-14-26)21-25-17-19-27(20-18-25)28-15-10-11-16-29(28)31(33)35-36-34/h7-11,13-20,23,30H,4-6,12,21-22H2,1-3H3,(H3,33,34,35)/t30-/m0/s1 |
| InChIKey | JOEGKAFGXFRWOY-PMERELPUSA-N |
| XLogP | 7.28 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|