C29H40BNO5 — CID 24886659
benzyl (2S)-2-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl-pentanoylamino]-3-methylbutanoate (PubChem CID 24886659) has the molecular formula C29H40BNO5 and a molecular weight of 493.45 g/mol. Its IUPAC name is benzyl (2S)-2-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl-pentanoylamino]-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl-pentanoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 24886659 |
| Molecular Formula | C29H40BNO5 |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | benzyl (2S)-2-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl-pentanoylamino]-3-methylbutanoate |
| SMILES | CCCCC(=O)N(Cc1ccc(B2OCC(C)(C)CO2)cc1)[C@H](C(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C29H40BNO5/c1-6-7-13-26(32)31(27(22(2)3)28(33)34-19-24-11-9-8-10-12-24)18-23-14-16-25(17-15-23)30-35-20-29(4,5)21-36-30/h8-12,14-17,22,27H,6-7,13,18-21H2,1-5H3/t27-/m0/s1 |
| InChIKey | XRXBFOUXGDXVAT-MHZLTWQESA-N |
| XLogP | 4.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|