C17H25BO3 — CID 25258886
1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]hexan-1-one (PubChem CID 25258886) has the molecular formula C17H25BO3 and a molecular weight of 288.20 g/mol. Its IUPAC name is 1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]hexan-1-one.
| Compound Name | 1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]hexan-1-one |
|---|---|
| PubChem CID | 25258886 |
| Molecular Formula | C17H25BO3 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]hexan-1-one |
| SMILES | CCCCCC(=O)c1ccc(B2OCC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C17H25BO3/c1-4-5-6-7-16(19)14-8-10-15(11-9-14)18-20-12-17(2,3)13-21-18/h8-11H,4-7,12-13H2,1-3H3 |
| InChIKey | PFILTYOHLQTOKS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|