C28H36B2O6 — CID 59616952
1,4-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,4-dione (PubChem CID 59616952) has the molecular formula C28H36B2O6 and a molecular weight of 490.21 g/mol. Its IUPAC name is 1,4-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,4-dione.
| Compound Name | 1,4-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,4-dione |
|---|---|
| PubChem CID | 59616952 |
| Molecular Formula | C28H36B2O6 |
| Molecular Weight | 490.21 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 1,4-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,4-dione |
| SMILES | CC1(C)OB(c2ccc(C(=O)CCC(=O)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C28H36B2O6/c1-25(2)26(3,4)34-29(33-25)21-13-9-19(10-14-21)23(31)17-18-24(32)20-11-15-22(16-12-20)30-35-27(5,6)28(7,8)36-30/h9-16H,17-18H2,1-8H3 |
| InChIKey | HFGBWCNGHNRESY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.21 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|