C16H23BO2 — CID 145014967
2-(4-but-1-en-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 145014967) has the molecular formula C16H23BO2 and a molecular weight of 258.17 g/mol. Its IUPAC name is 2-(4-but-1-en-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4-but-1-en-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145014967 |
| Molecular Formula | C16H23BO2 |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-(4-but-1-en-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(CC)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C16H23BO2/c1-7-12(2)13-8-10-14(11-9-13)17-18-15(3,4)16(5,6)19-17/h8-11H,2,7H2,1,3-6H3 |
| InChIKey | OGJRROXIWKIJSX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|