C14H19BO2 — CID 23629516
2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 23629516) has the molecular formula C14H19BO2 and a molecular weight of 230.12 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 23629516 |
| Molecular Formula | C14H19BO2 |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C14H19BO2/c1-6-11-7-9-12(10-8-11)15-16-13(2,3)14(4,5)17-15/h6-10H,1H2,2-5H3 |
| InChIKey | ONBKTEDYJFZZCU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|