C17H31BO2 — CID 142330584
ethane;4,4,5,5-tetramethyl-2-(4-methylphenyl)-1,3,2-dioxaborolane (PubChem CID 142330584) has the molecular formula C17H31BO2 and a molecular weight of 278.25 g/mol. Its IUPAC name is ethane;4,4,5,5-tetramethyl-2-(4-methylphenyl)-1,3,2-dioxaborolane.
| Compound Name | ethane;4,4,5,5-tetramethyl-2-(4-methylphenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142330584 |
| Molecular Formula | C17H31BO2 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | ethane;4,4,5,5-tetramethyl-2-(4-methylphenyl)-1,3,2-dioxaborolane |
| SMILES | CC.CC.Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C13H19BO2.2C2H6/c1-10-6-8-11(9-7-10)14-15-12(2,3)13(4,5)16-14;2*1-2/h6-9H,1-5H3;2*1-2H3 |
| InChIKey | WTQDEDLOMHBMHB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|