C26H32B2O6 — CID 68776148
1,2-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethane-1,2-dione (PubChem CID 68776148) has the molecular formula C26H32B2O6 and a molecular weight of 462.16 g/mol. Its IUPAC name is 1,2-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethane-1,2-dione.
| Compound Name | 1,2-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 68776148 |
| Molecular Formula | C26H32B2O6 |
| Molecular Weight | 462.16 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 1,2-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethane-1,2-dione |
| SMILES | CC1(C)OB(c2ccc(C(=O)C(=O)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C26H32B2O6/c1-23(2)24(3,4)32-27(31-23)19-13-9-17(10-14-19)21(29)22(30)18-11-15-20(16-12-18)28-33-25(5,6)26(7,8)34-28/h9-16H,1-8H3 |
| InChIKey | BDTMRQVYWGTPFO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|