C18H24BNO3 — CID 166001366
N-(1-bicyclo[1.1.1]pentanyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 166001366) has the molecular formula C18H24BNO3 and a molecular weight of 313.21 g/mol. Its IUPAC name is N-(1-bicyclo[1.1.1]pentanyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N-(1-bicyclo[1.1.1]pentanyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 166001366 |
| Molecular Formula | C18H24BNO3 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-(1-bicyclo[1.1.1]pentanyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)OB(c2ccc(C(=O)NC34CC(C3)C4)cc2)OC1(C)C |
| InChI | InChI=1S/C18H24BNO3/c1-16(2)17(3,4)23-19(22-16)14-7-5-13(6-8-14)15(21)20-18-9-12(10-18)11-18/h5-8,12H,9-11H2,1-4H3,(H,20,21) |
| InChIKey | VZEYIRCQYDJZSN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|