C18H23BClNO3 — CID 176731373
N-(1-bicyclo[1.1.1]pentanyl)-3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 176731373) has the molecular formula C18H23BClNO3 and a molecular weight of 347.65 g/mol. Its IUPAC name is N-(1-bicyclo[1.1.1]pentanyl)-3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N-(1-bicyclo[1.1.1]pentanyl)-3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 176731373 |
| Molecular Formula | C18H23BClNO3 |
| Molecular Weight | 347.65 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-(1-bicyclo[1.1.1]pentanyl)-3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)OB(c2ccc(C(=O)NC34CC(C3)C4)cc2Cl)OC1(C)C |
| InChI | InChI=1S/C18H23BClNO3/c1-16(2)17(3,4)24-19(23-16)13-6-5-12(7-14(13)20)15(22)21-18-8-11(9-18)10-18/h5-7,11H,8-10H2,1-4H3,(H,21,22) |
| InChIKey | BMMUGWHJRDWTST-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|