C19H29BCl2N2O3 — CID 176731271
3-chloro-N-methyl-N-piperidin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;hydrochloride (PubChem CID 176731271) has the molecular formula C19H29BCl2N2O3 and a molecular weight of 415.17 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-piperidin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;hydrochloride.
| Compound Name | 3-chloro-N-methyl-N-piperidin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 176731271 |
| Molecular Formula | C19H29BCl2N2O3 |
| Molecular Weight | 415.17 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-chloro-N-methyl-N-piperidin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;hydrochloride |
| SMILES | CN(C(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)c(Cl)c1)C1CCNCC1.Cl |
| InChI | InChI=1S/C19H28BClN2O3.ClH/c1-18(2)19(3,4)26-20(25-18)15-7-6-13(12-16(15)21)17(24)23(5)14-8-10-22-11-9-14;/h6-7,12,14,22H,8-11H2,1-5H3;1H |
| InChIKey | ICBFVONZNCTCLJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|