C14H18N2O3 — CID 12641855
N-methyl-N-piperidin-4-yl-1,3-benzodioxole-5-carboxamide (PubChem CID 12641855) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-methyl-N-piperidin-4-yl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-methyl-N-piperidin-4-yl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 12641855 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-methyl-N-piperidin-4-yl-1,3-benzodioxole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)OCO2)C1CCNCC1 |
| InChI | InChI=1S/C14H18N2O3/c1-16(11-4-6-15-7-5-11)14(17)10-2-3-12-13(8-10)19-9-18-12/h2-3,8,11,15H,4-7,9H2,1H3 |
| InChIKey | LRZHOCNFEVMDQY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |